C30H42O6 — CID 162891825
[2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 2-methylbut-2-enoate (PubChem CID 162891825) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 2-methylbut-2-enoate.
| Compound Name | [2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162891825 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C2C(OC(O)C23CC=C(CCC=C(C)C)CC3)C(O)C(C)C2C=CC(=O)C21C |
| InChI | InChI=1S/C30H42O6/c1-7-18(4)27(33)36-26-23-25(24(32)19(5)21-11-12-22(31)29(21,26)6)35-28(34)30(23)15-13-20(14-16-30)10-8-9-17(2)3/h7,9,11-13,19,21,23-26,28,32,34H,8,10,14-16H2,1-6H3 |
| InChIKey | POIFFJRCDYNIQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|