C28H36O8 — CID 162899630
[5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-13-yl]methyl acetate (PubChem CID 162899630) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is [5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-13-yl]methyl acetate.
| Compound Name | [5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-13-yl]methyl acetate |
|---|---|
| PubChem CID | 162899630 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-13-yl]methyl acetate |
| SMILES | CC(=O)OCC12C3CC4CC1(CCC1C2CCC2(C)C(c5ccc(=O)oc5)CCC12O)OC(C)(O4)O3 |
| InChI | InChI=1S/C28H36O8/c1-16(29)33-15-27-20-6-9-24(2)19(17-4-5-23(30)32-14-17)8-11-28(24,31)21(20)7-10-26(27)13-18-12-22(27)35-25(3,34-18)36-26/h4-5,14,18-22,31H,6-13,15H2,1-3H3 |
| InChIKey | RRDZJCCZVWCHID-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |