C26H34O8 — CID 162939550
5-[5,11-dihydroxy-13-(hydroxymethyl)-9,16-dimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl]pyran-2-one (PubChem CID 162939550) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is 5-[5,11-dihydroxy-13-(hydroxymethyl)-9,16-dimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl]pyran-2-one.
| Compound Name | 5-[5,11-dihydroxy-13-(hydroxymethyl)-9,16-dimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl]pyran-2-one |
|---|---|
| PubChem CID | 162939550 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 5-[5,11-dihydroxy-13-(hydroxymethyl)-9,16-dimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl]pyran-2-one |
| SMILES | CC12OC3CC(O1)C1(CO)C4C(O)CC5(C)C(c6ccc(=O)oc6)CCC5(O)C4CCC1(C3)O2 |
| InChI | InChI=1S/C26H34O8/c1-22-11-18(28)21-17(26(22,30)8-6-16(22)14-3-4-20(29)31-12-14)5-7-24-10-15-9-19(25(21,24)13-27)33-23(2,32-15)34-24/h3-4,12,15-19,21,27-28,30H,5-11,13H2,1-2H3 |
| InChIKey | IROGPDLPDYVVFG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |