C26H34O6 — CID 4281913
5-(5-hydroxy-9,13,16-trimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl)pyran-2-one (PubChem CID 4281913) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 5-(5-hydroxy-9,13,16-trimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl)pyran-2-one.
| Compound Name | 5-(5-hydroxy-9,13,16-trimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl)pyran-2-one |
|---|---|
| PubChem CID | 4281913 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 5-(5-hydroxy-9,13,16-trimethyl-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosan-8-yl)pyran-2-one |
| SMILES | CC12OC3CC(O1)C1(C)C4CCC5(C)C(c6ccc(=O)oc6)CCC5(O)C4CCC1(C3)O2 |
| InChI | InChI=1S/C26H34O6/c1-22-9-6-18-19(26(22,28)11-8-17(22)15-4-5-21(27)29-14-15)7-10-25-13-16-12-20(23(18,25)2)31-24(3,30-16)32-25/h4-5,14,16-20,28H,6-13H2,1-3H3 |
| InChIKey | BVIKZDOSWIBQSC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |