C26H32O7 — CID 162930230
(1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde (PubChem CID 162930230) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde.
| Compound Name | (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde |
|---|---|
| PubChem CID | 162930230 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9,16-dimethyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde |
| SMILES | C[C@@]12O[C@H]3C[C@@H](O1)[C@]1(C=O)[C@@H]4CC[C@]5(C)[C@@H](c6ccc(=O)oc6)CC[C@]5(O)[C@H]4CC[C@@]1(C3)O2 |
| InChI | InChI=1S/C26H32O7/c1-22-8-5-18-19(26(22,29)10-7-17(22)15-3-4-21(28)30-13-15)6-9-24-12-16-11-20(25(18,24)14-27)32-23(2,31-16)33-24/h3-4,13-14,16-20,29H,5-12H2,1-2H3/t16-,17+,18+,19-,20+,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | QMZMTFLDQTWANC-WKIWGQOESA-N |
| XLogP | 3.28 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|