C25H30O7 — CID 163093312
(1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9-methyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde (PubChem CID 163093312) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9-methyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde.
| Compound Name | (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9-methyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde |
|---|---|
| PubChem CID | 163093312 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (1S,4S,5S,8R,9R,12R,13R,14R,16R,18S)-5-hydroxy-9-methyl-8-(6-oxopyran-3-yl)-15,17,20-trioxahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane-13-carbaldehyde |
| SMILES | C[C@]12CC[C@@H]3[C@H](CC[C@@]45C[C@@H]6C[C@@H](O[C@@H](O6)O4)[C@]35C=O)[C@@]1(O)CC[C@@H]2c1ccc(=O)oc1 |
| InChI | InChI=1S/C25H30O7/c1-22-7-4-17-18(25(22,28)9-6-16(22)14-2-3-20(27)29-12-14)5-8-23-11-15-10-19(24(17,23)13-26)31-21(30-15)32-23/h2-3,12-13,15-19,21,28H,4-11H2,1H3/t15-,16+,17+,18-,19+,21+,22+,23-,24-,25-/m0/s1 |
| InChIKey | JOXNMSMDEQEGKG-ZLTLVLKLSA-N |
| XLogP | 2.89 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|