C26H33NO8 — CID 162902210
(6R,6aS,7S,9S,10aS)-7-[(2R,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9-trihydroxy-6a,7,8,10,10a,11-hexahydro-6H-tetracene-5,12-dione (PubChem CID 162902210) has the molecular formula C26H33NO8 and a molecular weight of 487.55 g/mol. Its IUPAC name is (6R,6aS,7S,9S,10aS)-7-[(2R,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9-trihydroxy-6a,7,8,10,10a,11-hexahydro-6H-tetracene-5,12-dione.
| Compound Name | (6R,6aS,7S,9S,10aS)-7-[(2R,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9-trihydroxy-6a,7,8,10,10a,11-hexahydro-6H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 162902210 |
| Molecular Formula | C26H33NO8 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (6R,6aS,7S,9S,10aS)-7-[(2R,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9-trihydroxy-6a,7,8,10,10a,11-hexahydro-6H-tetracene-5,12-dione |
| SMILES | CC[C@]1(O)C[C@@H]2CC3=C(C(=O)c4c(O)cccc4C3=O)[C@H](O)[C@H]2[C@@H](O[C@H]2C[C@@H](N)[C@@H](O)[C@@H](C)O2)C1 |
| InChI | InChI=1S/C26H33NO8/c1-3-26(33)9-12-7-14-21(25(32)20-13(23(14)30)5-4-6-16(20)28)24(31)19(12)17(10-26)35-18-8-15(27)22(29)11(2)34-18/h4-6,11-12,15,17-19,22,24,28-29,31,33H,3,7-10,27H2,1-2H3/t11-,12+,15-,17+,18+,19-,22+,24-,26+/m1/s1 |
| InChIKey | STXXCRPLQSVQRE-AFMMLPODSA-N |
| XLogP | 1.21 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|