C28H39NO6 — CID 162913158
5,7-dihydroxy-2-(3-methylbutyl)-3-oxo-6-(3-oxotetradeca-4,6-dienyl)-1H-isoindole-4-carboxylic acid (PubChem CID 162913158) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(3-methylbutyl)-3-oxo-6-(3-oxotetradeca-4,6-dienyl)-1H-isoindole-4-carboxylic acid.
| Compound Name | 5,7-dihydroxy-2-(3-methylbutyl)-3-oxo-6-(3-oxotetradeca-4,6-dienyl)-1H-isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 162913158 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 5,7-dihydroxy-2-(3-methylbutyl)-3-oxo-6-(3-oxotetradeca-4,6-dienyl)-1H-isoindole-4-carboxylic acid |
| SMILES | CCCCCCCC=CC=CC(=O)CCc1c(O)c2c(c(C(=O)O)c1O)C(=O)N(CCC(C)C)C2 |
| InChI | InChI=1S/C28H39NO6/c1-4-5-6-7-8-9-10-11-12-13-20(30)14-15-21-25(31)22-18-29(17-16-19(2)3)27(33)23(22)24(26(21)32)28(34)35/h10-13,19,31-32H,4-9,14-18H2,1-3H3,(H,34,35) |
| InChIKey | MTRQOGAXJIIUAW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|