C23H31NO6 — CID 72748058
5,7-dihydroxy-3-oxo-6-(3-oxotetradec-4-enyl)-1,2-dihydroisoindole-4-carboxylic acid (PubChem CID 72748058) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 5,7-dihydroxy-3-oxo-6-(3-oxotetradec-4-enyl)-1,2-dihydroisoindole-4-carboxylic acid.
| Compound Name | 5,7-dihydroxy-3-oxo-6-(3-oxotetradec-4-enyl)-1,2-dihydroisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 72748058 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 5,7-dihydroxy-3-oxo-6-(3-oxotetradec-4-enyl)-1,2-dihydroisoindole-4-carboxylic acid |
| SMILES | CCCCCCCCCC=CC(=O)CCc1c(O)c2c(c(C(=O)O)c1O)C(=O)NC2 |
| InChI | InChI=1S/C23H31NO6/c1-2-3-4-5-6-7-8-9-10-11-15(25)12-13-16-20(26)17-14-24-22(28)18(17)19(21(16)27)23(29)30/h10-11,26-27H,2-9,12-14H2,1H3,(H,24,28)(H,29,30) |
| InChIKey | ULFALXMSXVAKOT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|