C23H30O7 — CID 163185527
(3R)-3,5,7-trihydroxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzofuran-4-carbaldehyde (PubChem CID 163185527) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is (3R)-3,5,7-trihydroxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzofuran-4-carbaldehyde.
| Compound Name | (3R)-3,5,7-trihydroxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 163185527 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3R)-3,5,7-trihydroxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzofuran-4-carbaldehyde |
| SMILES | CCCCCCCCC/C=C/C(=O)CCc1c(O)c(C=O)c2c(c1O)C(=O)O[C@H]2O |
| InChI | InChI=1S/C23H30O7/c1-2-3-4-5-6-7-8-9-10-11-15(25)12-13-16-20(26)17(14-24)18-19(21(16)27)23(29)30-22(18)28/h10-11,14,22,26-28H,2-9,12-13H2,1H3/b11-10+/t22-/m1/s1 |
| InChIKey | IPXWNHKZNHVKLL-NELJVSICSA-N |
| XLogP | 4.27 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|