C26H33NO8 — CID 162914556
[5-[5-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-1,4-dihydroxy-6-oxo-3-pyridinyl]-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl] acetate (PubChem CID 162914556) has the molecular formula C26H33NO8 and a molecular weight of 487.55 g/mol. Its IUPAC name is [5-[5-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-1,4-dihydroxy-6-oxo-3-pyridinyl]-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl] acetate.
| Compound Name | [5-[5-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-1,4-dihydroxy-6-oxo-3-pyridinyl]-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 162914556 |
| Molecular Formula | C26H33NO8 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [5-[5-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-1,4-dihydroxy-6-oxo-3-pyridinyl]-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
| SMILES | CC(=O)OC1CCC(O)(c2cn(O)c(=O)c(C(=O)C3C(C)C=CC4CC(C)CCC43)c2O)C2OC12 |
| InChI | InChI=1S/C26H33NO8/c1-12-4-7-16-15(10-12)6-5-13(2)19(16)22(30)20-21(29)17(11-27(33)25(20)31)26(32)9-8-18(34-14(3)28)23-24(26)35-23/h5-6,11-13,15-16,18-19,23-24,29,32-33H,4,7-10H2,1-3H3 |
| InChIKey | XJGASSGRQMFKDJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|