C26H37NO6 — CID 163102881
3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-methyl-5-(2,3,4-trihydroxy-1-methoxycyclohexyl)-1H-pyridin-2-one (PubChem CID 163102881) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-methyl-5-(2,3,4-trihydroxy-1-methoxycyclohexyl)-1H-pyridin-2-one.
| Compound Name | 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-methyl-5-(2,3,4-trihydroxy-1-methoxycyclohexyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163102881 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 3-(2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-4-methyl-5-(2,3,4-trihydroxy-1-methoxycyclohexyl)-1H-pyridin-2-one |
| SMILES | COC1(c2c[nH]c(=O)c(C(=O)C3C(C)C=CC4CC(C)CCC43)c2C)CCC(O)C(O)C1O |
| InChI | InChI=1S/C26H37NO6/c1-13-5-8-17-16(11-13)7-6-14(2)20(17)23(30)21-15(3)18(12-27-25(21)32)26(33-4)10-9-19(28)22(29)24(26)31/h6-7,12-14,16-17,19-20,22,24,28-29,31H,5,8-11H2,1-4H3,(H,27,32) |
| InChIKey | KWYUDINJQJSPSU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|