C25H35NO7 — CID 163111964
3-[(1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-4-hydroxy-5-[(1S,2R,3S,4R)-2,3,4-trihydroxy-1-methoxycyclohexyl]-1H-pyridin-2-one (PubChem CID 163111964) has the molecular formula C25H35NO7 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[(1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-4-hydroxy-5-[(1S,2R,3S,4R)-2,3,4-trihydroxy-1-methoxycyclohexyl]-1H-pyridin-2-one.
| Compound Name | 3-[(1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-4-hydroxy-5-[(1S,2R,3S,4R)-2,3,4-trihydroxy-1-methoxycyclohexyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163111964 |
| Molecular Formula | C25H35NO7 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 3-[(1R,2R,4aS,6R,8aR)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-4-hydroxy-5-[(1S,2R,3S,4R)-2,3,4-trihydroxy-1-methoxycyclohexyl]-1H-pyridin-2-one |
| SMILES | CO[C@]1(c2c[nH]c(=O)c(C(=O)[C@H]3[C@@H]4CC[C@@H](C)C[C@H]4C=C[C@H]3C)c2O)CC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H35NO7/c1-12-4-7-15-14(10-12)6-5-13(2)18(15)22(30)19-20(28)16(11-26-24(19)32)25(33-3)9-8-17(27)21(29)23(25)31/h5-6,11-15,17-18,21,23,27,29,31H,4,7-10H2,1-3H3,(H2,26,28,32)/t12-,13-,14-,15-,17-,18-,21+,23-,25+/m1/s1 |
| InChIKey | ONECZFKUWUBNAO-YQWLYJFGSA-N |
| XLogP | 1.86 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|