C26H40O7 — CID 162916722
[(1R,2S,4R,5R,9S,10Z,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E)-3-methylpent-2-enoate (PubChem CID 162916722) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(1R,2S,4R,5R,9S,10Z,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E)-3-methylpent-2-enoate.
| Compound Name | [(1R,2S,4R,5R,9S,10Z,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162916722 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(1R,2S,4R,5R,9S,10Z,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E)-3-methylpent-2-enoate |
| SMILES | CC/C(C)=C/C(=O)O[C@H]1C(=O)[C@@H](O)[C@@]2(C)CC[C@H](O2)C(C)(C)/C=C\[C@H](C)C(=O)C(O)C[C@H]1C |
| InChI | InChI=1S/C26H40O7/c1-8-15(2)13-20(28)32-23-17(4)14-18(27)21(29)16(3)9-11-25(5,6)19-10-12-26(7,33-19)24(31)22(23)30/h9,11,13,16-19,23-24,27,31H,8,10,12,14H2,1-7H3/b11-9-,15-13+/t16-,17+,18?,19-,23+,24+,26+/m0/s1 |
| InChIKey | QYBXOOVCAISOJS-AMRCUPDFSA-N |
| XLogP | 3.31 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|