C21H28O6 — CID 163043544
(4,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl) 3-methylpent-2-enoate (PubChem CID 163043544) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (4,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl) 3-methylpent-2-enoate.
| Compound Name | (4,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl) 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 163043544 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (4,9a-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-6-yl) 3-methylpent-2-enoate |
| SMILES | CCC(C)=CC(=O)OC1CC=C2CC3(O)OC(=O)C(C)=C3C(O)C2(C)C1C |
| InChI | InChI=1S/C21H28O6/c1-6-11(2)9-16(22)26-15-8-7-14-10-21(25)17(12(3)19(24)27-21)18(23)20(14,5)13(15)4/h7,9,13,15,18,23,25H,6,8,10H2,1-5H3 |
| InChIKey | GOYCTRMVTOTXSN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|