C15H18O4 — CID 162924320
(1R,8S,11R,12S,14R)-14-methyl-5-oxo-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-14-carboxylic acid (PubChem CID 162924320) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R,8S,11R,12S,14R)-14-methyl-5-oxo-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-14-carboxylic acid.
| Compound Name | (1R,8S,11R,12S,14R)-14-methyl-5-oxo-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-14-carboxylic acid |
|---|---|
| PubChem CID | 162924320 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,8S,11R,12S,14R)-14-methyl-5-oxo-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-14-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)[C@@H]2CC=C3C(=O)OC[C@H]4CC[C@@H]1[C@]34C2 |
| InChI | InChI=1S/C15H18O4/c1-14(13(17)18)8-2-4-10-12(16)19-7-9-3-5-11(14)15(9,10)6-8/h4,8-9,11H,2-3,5-7H2,1H3,(H,17,18)/t8-,9-,11+,14-,15+/m1/s1 |
| InChIKey | DRUHGGPFJWGIQH-ZEROOKDJSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |