C15H20O3 — CID 163104439
(1R,7R,8R,11S,12S)-7-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one (PubChem CID 163104439) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,7R,8R,11S,12S)-7-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one.
| Compound Name | (1R,7R,8R,11S,12S)-7-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
|---|---|
| PubChem CID | 163104439 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,7R,8R,11S,12S)-7-hydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
| SMILES | CC1(C)[C@@H]2CC=C3C(=O)O[C@@H](O)[C@@H]4CC[C@@H]1[C@]34C2 |
| InChI | InChI=1S/C15H20O3/c1-14(2)8-3-4-9-12(16)18-13(17)10-5-6-11(14)15(9,10)7-8/h4,8,10-11,13,17H,3,5-7H2,1-2H3/t8-,10+,11+,13-,15-/m1/s1 |
| InChIKey | IKHDDOCXVPLQIO-HTQYSMPGSA-N |
| XLogP | 2.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |