C15H20O2 — CID 162865711
(1R,8R,11S,12S)-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one (PubChem CID 162865711) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1R,8R,11S,12S)-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one.
| Compound Name | (1R,8R,11S,12S)-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
|---|---|
| PubChem CID | 162865711 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1R,8R,11S,12S)-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
| SMILES | CC1(C)[C@@H]2CC=C3C(=O)OC[C@@H]4CC[C@@H]1[C@]34C2 |
| InChI | InChI=1S/C15H20O2/c1-14(2)9-3-5-11-13(16)17-8-10-4-6-12(14)15(10,11)7-9/h5,9-10,12H,3-4,6-8H2,1-2H3/t9-,10+,12+,15+/m1/s1 |
| InChIKey | ADOYHGWXKOUPHN-YOLKCXPHSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |