C37H41NO6S2 — CID 162924615
8,17-dihydroxy-25-[(3-hydroxyphenyl)-(methylamino)methoxy]-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one (PubChem CID 162924615) has the molecular formula C37H41NO6S2 and a molecular weight of 659.87 g/mol. Its IUPAC name is 8,17-dihydroxy-25-[(3-hydroxyphenyl)-(methylamino)methoxy]-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one.
| Compound Name | 8,17-dihydroxy-25-[(3-hydroxyphenyl)-(methylamino)methoxy]-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one |
|---|---|
| PubChem CID | 162924615 |
| Molecular Formula | C37H41NO6S2 |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.24 |
| IUPAC Name | 8,17-dihydroxy-25-[(3-hydroxyphenyl)-(methylamino)methoxy]-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one |
| SMILES | CNC(OC1CC(=O)CCc2ccc(O)c(OC)c2-c2ccc3ccc(O)cc3c2CSSC2CCC1CC2)c1cccc(O)c1 |
| InChI | InChI=1S/C37H41NO6S2/c1-38-37(25-4-3-5-26(39)18-25)44-34-20-28(41)13-7-24-11-17-33(42)36(43-2)35(24)30-16-10-22-6-12-27(40)19-31(22)32(30)21-45-46-29-14-8-23(34)9-15-29/h3-6,10-12,16-19,23,29,34,37-40,42H,7-9,13-15,20-21H2,1-2H3 |
| InChIKey | HZJZSOFWNCDUKN-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|