C29H32O6S2 — CID 163096169
(1S,25S,26R,28R)-8,17,25,28-tetrahydroxy-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one (PubChem CID 163096169) has the molecular formula C29H32O6S2 and a molecular weight of 540.70 g/mol. Its IUPAC name is (1S,25S,26R,28R)-8,17,25,28-tetrahydroxy-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one.
| Compound Name | (1S,25S,26R,28R)-8,17,25,28-tetrahydroxy-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one |
|---|---|
| PubChem CID | 163096169 |
| Molecular Formula | C29H32O6S2 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | (1S,25S,26R,28R)-8,17,25,28-tetrahydroxy-16-methoxy-2,3-dithiapentacyclo[24.2.2.05,14.06,11.015,20]triaconta-5(14),6(11),7,9,12,15(20),16,18-octaen-23-one |
| SMILES | COc1c(O)ccc2c1-c1ccc3ccc(O)cc3c1CSS[C@H]1CC[C@H](C[C@H]1O)[C@@H](O)CC(=O)CC2 |
| InChI | InChI=1S/C29H32O6S2/c1-35-29-24(32)10-5-17-3-8-20(31)14-25(33)18-6-11-27(26(34)12-18)37-36-15-23-21(28(17)29)9-4-16-2-7-19(30)13-22(16)23/h2,4-5,7,9-10,13,18,25-27,30,32-34H,3,6,8,11-12,14-15H2,1H3/t18-,25+,26-,27+/m1/s1 |
| InChIKey | JBVWVZYUXLXYMK-ODOWTIOMSA-N |
| XLogP | 5.60 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|