C34H43NO6S2 — CID 162982068
12-[(cyclohexylamino)methoxy]-4,15,23-trihydroxy-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one (PubChem CID 162982068) has the molecular formula C34H43NO6S2 and a molecular weight of 625.85 g/mol. Its IUPAC name is 12-[(cyclohexylamino)methoxy]-4,15,23-trihydroxy-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one.
| Compound Name | 12-[(cyclohexylamino)methoxy]-4,15,23-trihydroxy-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
|---|---|
| PubChem CID | 162982068 |
| Molecular Formula | C34H43NO6S2 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 12-[(cyclohexylamino)methoxy]-4,15,23-trihydroxy-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
| SMILES | COc1c(O)ccc2c1-c1ccc3ccc(O)cc3c1CSSCC(O)CCC(OCNC1CCCCC1)CC(=O)CC2 |
| InChI | InChI=1S/C34H43NO6S2/c1-40-34-32(39)16-10-23-8-12-25(36)17-28(41-21-35-24-5-3-2-4-6-24)14-13-27(38)19-42-43-20-31-29(33(23)34)15-9-22-7-11-26(37)18-30(22)31/h7,9-11,15-16,18,24,27-28,35,37-39H,2-6,8,12-14,17,19-21H2,1H3 |
| InChIKey | RLIQSQSUXRIOGJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|