C35H39NO6S2 — CID 163102587
4,23-dihydroxy-12-[(3-hydroxyphenyl)-(methylamino)methoxy]-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one (PubChem CID 163102587) has the molecular formula C35H39NO6S2 and a molecular weight of 633.83 g/mol. Its IUPAC name is 4,23-dihydroxy-12-[(3-hydroxyphenyl)-(methylamino)methoxy]-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one.
| Compound Name | 4,23-dihydroxy-12-[(3-hydroxyphenyl)-(methylamino)methoxy]-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
|---|---|
| PubChem CID | 163102587 |
| Molecular Formula | C35H39NO6S2 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 4,23-dihydroxy-12-[(3-hydroxyphenyl)-(methylamino)methoxy]-3-methoxy-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
| SMILES | CNC(OC1CCCCSSCc2c(ccc3ccc(O)cc23)-c2c(ccc(O)c2OC)CCC(=O)C1)c1cccc(O)c1 |
| InChI | InChI=1S/C35H39NO6S2/c1-36-35(24-6-5-7-25(37)18-24)42-28-8-3-4-17-43-44-21-31-29(15-11-22-9-13-27(39)20-30(22)31)33-23(10-14-26(38)19-28)12-16-32(40)34(33)41-2/h5-7,9,11-13,15-16,18,20,28,35-37,39-40H,3-4,8,10,14,17,19,21H2,1-2H3 |
| InChIKey | NEEHQXFBTHMKGK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|