C36H41NO5S2 — CID 163063738
4,23-dihydroxy-3-methoxy-12-[(2-phenylethylamino)methoxy]-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one (PubChem CID 163063738) has the molecular formula C36H41NO5S2 and a molecular weight of 631.86 g/mol. Its IUPAC name is 4,23-dihydroxy-3-methoxy-12-[(2-phenylethylamino)methoxy]-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one.
| Compound Name | 4,23-dihydroxy-3-methoxy-12-[(2-phenylethylamino)methoxy]-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
|---|---|
| PubChem CID | 163063738 |
| Molecular Formula | C36H41NO5S2 |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 4,23-dihydroxy-3-methoxy-12-[(2-phenylethylamino)methoxy]-17,18-dithiatetracyclo[18.8.0.02,7.021,26]octacosa-1(20),2(7),3,5,21(26),22,24,27-octaen-10-one |
| SMILES | COc1c(O)ccc2c1-c1ccc3ccc(O)cc3c1CSSCCCCC(OCNCCc1ccccc1)CC(=O)CC2 |
| InChI | InChI=1S/C36H41NO5S2/c1-41-36-34(40)17-13-27-11-15-28(38)21-30(42-24-37-19-18-25-7-3-2-4-8-25)9-5-6-20-43-44-23-33-31(35(27)36)16-12-26-10-14-29(39)22-32(26)33/h2-4,7-8,10,12-14,16-17,22,30,37,39-40H,5-6,9,11,15,18-21,23-24H2,1H3 |
| InChIKey | HXGNZGYOHWNLLG-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|