C31H37NO6S2 — CID 162831637
5,14,25-trihydroxy-13-methoxy-22-(methylaminomethoxy)-27,28-dithiapentacyclo[21.5.2.02,11.03,8.012,17]triaconta-2(11),3(8),4,6,9,12(17),13,15-octaen-20-one (PubChem CID 162831637) has the molecular formula C31H37NO6S2 and a molecular weight of 583.77 g/mol. Its IUPAC name is 5,14,25-trihydroxy-13-methoxy-22-(methylaminomethoxy)-27,28-dithiapentacyclo[21.5.2.02,11.03,8.012,17]triaconta-2(11),3(8),4,6,9,12(17),13,15-octaen-20-one.
| Compound Name | 5,14,25-trihydroxy-13-methoxy-22-(methylaminomethoxy)-27,28-dithiapentacyclo[21.5.2.02,11.03,8.012,17]triaconta-2(11),3(8),4,6,9,12(17),13,15-octaen-20-one |
|---|---|
| PubChem CID | 162831637 |
| Molecular Formula | C31H37NO6S2 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 5,14,25-trihydroxy-13-methoxy-22-(methylaminomethoxy)-27,28-dithiapentacyclo[21.5.2.02,11.03,8.012,17]triaconta-2(11),3(8),4,6,9,12(17),13,15-octaen-20-one |
| SMILES | CNCOC1CC(=O)CCc2ccc(O)c(OC)c2-c2ccc3ccc(O)cc3c2C2CCC1CC(O)CSS2 |
| InChI | InChI=1S/C31H37NO6S2/c1-32-17-38-27-15-22(34)9-4-19-6-11-26(36)31(37-2)29(19)24-10-5-18-3-8-21(33)14-25(18)30(24)28-12-7-20(27)13-23(35)16-39-40-28/h3,5-6,8,10-11,14,20,23,27-28,32-33,35-36H,4,7,9,12-13,15-17H2,1-2H3 |
| InChIKey | OERYIYLVVSNKNF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|