C23H32O8 — CID 162924918
CID 162924918 (PubChem CID 162924918) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol.
| Compound Name | CID 162924918 |
|---|---|
| PubChem CID | 162924918 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | — |
| SMILES | CO[C@H]1CC[C@]2(CC[C@@]3(O2)[C@]2(CO2)C[C@@H](OC(C)=O)[C@@H]2[C@]34CCC[C@]2(C)C(=O)OC4)O1 |
| InChI | InChI=1S/C23H32O8/c1-14(24)29-15-11-21(13-28-21)23(10-9-22(31-23)8-5-16(26-3)30-22)20-7-4-6-19(2,17(15)20)18(25)27-12-20/h15-17H,4-13H2,1-3H3/t15-,16-,17+,19+,20-,21-,22+,23+/m1/s1 |
| InChIKey | FTCUDPODGIHZKH-VGTKKLITSA-N |
| XLogP | 2.47 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|