C14H27NO3 — CID 162925995
(E,4S,5S)-4,5-dihydroxy-N-(2-methylpropyl)dec-2-enamide (PubChem CID 162925995) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (E,4S,5S)-4,5-dihydroxy-N-(2-methylpropyl)dec-2-enamide.
| Compound Name | (E,4S,5S)-4,5-dihydroxy-N-(2-methylpropyl)dec-2-enamide |
|---|---|
| PubChem CID | 162925995 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (E,4S,5S)-4,5-dihydroxy-N-(2-methylpropyl)dec-2-enamide |
| SMILES | CCCCC[C@H](O)[C@@H](O)/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C14H27NO3/c1-4-5-6-7-12(16)13(17)8-9-14(18)15-10-11(2)3/h8-9,11-13,16-17H,4-7,10H2,1-3H3,(H,15,18)/b9-8+/t12-,13-/m0/s1 |
| InChIKey | GKAGMQMUZOEEEM-TYDXBBDOSA-N |
| XLogP | 1.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|