C43H54N4O4 — CID 162926378
2-(3-hydroxypropyl)-1-(2-phenylethyl)-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine (PubChem CID 162926378) has the molecular formula C43H54N4O4 and a molecular weight of 690.93 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-1-(2-phenylethyl)-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine.
| Compound Name | 2-(3-hydroxypropyl)-1-(2-phenylethyl)-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine |
|---|---|
| PubChem CID | 162926378 |
| Molecular Formula | C43H54N4O4 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.41 |
| IUPAC Name | 2-(3-hydroxypropyl)-1-(2-phenylethyl)-3-[13,14,21-trihydroxy-4-(1H-indol-2-ylmethyl)-21-methyl-11-pentacyclo[14.4.1.03,8.03,18.013,17]henicos-4-en-9-ynyl]guanidine |
| SMILES | CC1(O)C2CCC3C4C1CC(O)C4(O)CC(N/C(=N/CCCO)NCCc1ccccc1)C#CC1CCC=C(Cc4cc5ccccc5[nH]4)C13C2 |
| InChI | InChI=1S/C43H54N4O4/c1-41(50)32-16-18-35-39-36(41)25-38(49)43(39,51)27-33(47-40(44-20-8-22-48)45-21-19-28-9-3-2-4-10-28)17-15-30-12-7-13-31(42(30,35)26-32)24-34-23-29-11-5-6-14-37(29)46-34/h2-6,9-11,13-14,23,30,32-33,35-36,38-39,46,48-51H,7-8,12,16,18-22,24-27H2,1H3,(H2,44,45,47) |
| InChIKey | WHZCGSPLWHXIGD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|