C23H34O5 — CID 162928905
(3R,3aR,7aS)-6,7a-dimethyl-3-octanoyl-5-(2-oxopentyl)-3a,4-dihydro-3H-1-benzofuran-2,7-dione (PubChem CID 162928905) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (3R,3aR,7aS)-6,7a-dimethyl-3-octanoyl-5-(2-oxopentyl)-3a,4-dihydro-3H-1-benzofuran-2,7-dione.
| Compound Name | (3R,3aR,7aS)-6,7a-dimethyl-3-octanoyl-5-(2-oxopentyl)-3a,4-dihydro-3H-1-benzofuran-2,7-dione |
|---|---|
| PubChem CID | 162928905 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (3R,3aR,7aS)-6,7a-dimethyl-3-octanoyl-5-(2-oxopentyl)-3a,4-dihydro-3H-1-benzofuran-2,7-dione |
| SMILES | CCCCCCCC(=O)[C@@H]1C(=O)O[C@]2(C)C(=O)C(C)=C(CC(=O)CCC)C[C@H]12 |
| InChI | InChI=1S/C23H34O5/c1-5-7-8-9-10-12-19(25)20-18-14-16(13-17(24)11-6-2)15(3)21(26)23(18,4)28-22(20)27/h18,20H,5-14H2,1-4H3/t18-,20-,23+/m1/s1 |
| InChIKey | RXZCDZQEPIRHQP-XQFWAAQXSA-N |
| XLogP | 4.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|