C23H28O5 — CID 162955565
(6aS,9R,9aR)-6a-methyl-9-octanoyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione (PubChem CID 162955565) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (6aS,9R,9aR)-6a-methyl-9-octanoyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aS,9R,9aR)-6a-methyl-9-octanoyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 162955565 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (6aS,9R,9aR)-6a-methyl-9-octanoyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
| SMILES | C/C=C\C1=CC2=CC(=O)[C@@]3(C)OC(=O)[C@@H](C(=O)CCCCCCC)[C@@H]3C2=CO1 |
| InChI | InChI=1S/C23H28O5/c1-4-6-7-8-9-11-18(24)20-21-17-14-27-16(10-5-2)12-15(17)13-19(25)23(21,3)28-22(20)26/h5,10,12-14,20-21H,4,6-9,11H2,1-3H3/b10-5-/t20-,21-,23+/m0/s1 |
| InChIKey | CWVIMHNAZVLFBM-PJSAUUKOSA-N |
| XLogP | 4.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|