C24H28O6 — CID 162879048
(9R,9aR)-3-hexanoyl-9-hydroxy-9a-methyl-9-(2-oxopropyl)-6-prop-1-enylfuro[3,2-g]isochromen-2-one (PubChem CID 162879048) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (9R,9aR)-3-hexanoyl-9-hydroxy-9a-methyl-9-(2-oxopropyl)-6-prop-1-enylfuro[3,2-g]isochromen-2-one.
| Compound Name | (9R,9aR)-3-hexanoyl-9-hydroxy-9a-methyl-9-(2-oxopropyl)-6-prop-1-enylfuro[3,2-g]isochromen-2-one |
|---|---|
| PubChem CID | 162879048 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (9R,9aR)-3-hexanoyl-9-hydroxy-9a-methyl-9-(2-oxopropyl)-6-prop-1-enylfuro[3,2-g]isochromen-2-one |
| SMILES | CC=CC1=CC2=CC3=C(C(=O)CCCCC)C(=O)O[C@@]3(C)[C@@](O)(CC(C)=O)C2=CO1 |
| InChI | InChI=1S/C24H28O6/c1-5-7-8-10-20(26)21-18-12-16-11-17(9-6-2)29-14-19(16)24(28,13-15(3)25)23(18,4)30-22(21)27/h6,9,11-12,14,28H,5,7-8,10,13H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | UPAZQNSNYGRMJX-DNQXCXABSA-N |
| XLogP | 3.77 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|