C21H24O5 — CID 162992392
(6aR,9R,9aR)-9-hexanoyl-6a-methyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione (PubChem CID 162992392) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (6aR,9R,9aR)-9-hexanoyl-6a-methyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aR,9R,9aR)-9-hexanoyl-6a-methyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 162992392 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (6aR,9R,9aR)-9-hexanoyl-6a-methyl-3-[(Z)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
| SMILES | C/C=C\C1=CC2=CC(=O)[C@]3(C)OC(=O)[C@@H](C(=O)CCCCC)[C@@H]3C2=CO1 |
| InChI | InChI=1S/C21H24O5/c1-4-6-7-9-16(22)18-19-15-12-25-14(8-5-2)10-13(15)11-17(23)21(19,3)26-20(18)24/h5,8,10-12,18-19H,4,6-7,9H2,1-3H3/b8-5-/t18-,19-,21-/m0/s1 |
| InChIKey | NUJXNRMLMKAJSY-YXQFPGPNSA-N |
| XLogP | 3.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|