C21H28O5 — CID 68511205
(3S,3aR,9aR)-3-[(1S)-1-hydroxyhexyl]-9a-methyl-6-prop-1-enyl-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione (PubChem CID 68511205) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3S,3aR,9aR)-3-[(1S)-1-hydroxyhexyl]-9a-methyl-6-prop-1-enyl-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione.
| Compound Name | (3S,3aR,9aR)-3-[(1S)-1-hydroxyhexyl]-9a-methyl-6-prop-1-enyl-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione |
|---|---|
| PubChem CID | 68511205 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3S,3aR,9aR)-3-[(1S)-1-hydroxyhexyl]-9a-methyl-6-prop-1-enyl-3,3a,4,8-tetrahydrofuro[3,2-g]isochromene-2,9-dione |
| SMILES | CC=CC1=CC2=C(CO1)C(=O)[C@]1(C)OC(=O)[C@H]([C@@H](O)CCCCC)[C@H]1C2 |
| InChI | InChI=1S/C21H28O5/c1-4-6-7-9-17(22)18-16-11-13-10-14(8-5-2)25-12-15(13)19(23)21(16,3)26-20(18)24/h5,8,10,16-18,22H,4,6-7,9,11-12H2,1-3H3/t16-,17+,18+,21-/m1/s1 |
| InChIKey | GNZJIIUXMNGZCY-OEMYIYORSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|