C21H28O5 — CID 162929317
(4aS,10aS)-5-hydroxy-7-[(2S)-1-hydroxypropan-2-yl]-8-methoxy-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylic acid (PubChem CID 162929317) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (4aS,10aS)-5-hydroxy-7-[(2S)-1-hydroxypropan-2-yl]-8-methoxy-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylic acid.
| Compound Name | (4aS,10aS)-5-hydroxy-7-[(2S)-1-hydroxypropan-2-yl]-8-methoxy-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 162929317 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (4aS,10aS)-5-hydroxy-7-[(2S)-1-hydroxypropan-2-yl]-8-methoxy-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylic acid |
| SMILES | COc1c([C@H](C)CO)cc(O)c2c1CC[C@H]1C(C)=C(C(=O)O)CC[C@]21C |
| InChI | InChI=1S/C21H28O5/c1-11(10-22)15-9-17(23)18-14(19(15)26-4)5-6-16-12(2)13(20(24)25)7-8-21(16,18)3/h9,11,16,22-23H,5-8,10H2,1-4H3,(H,24,25)/t11-,16+,21+/m1/s1 |
| InChIKey | OLBWQSWJMYMYAR-DBLBYYFGSA-N |
| XLogP | 3.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |