C24H38O3Si — CID 10453756
[(4aS,10aR)-5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-yl]oxy-trimethylsilane (PubChem CID 10453756) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is [(4aS,10aR)-5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-yl]oxy-trimethylsilane.
| Compound Name | [(4aS,10aR)-5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10453756 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | [(4aS,10aR)-5,8-dimethoxy-1,4a-dimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-yl]oxy-trimethylsilane |
| SMILES | COc1cc(C(C)C)c(OC)c2c1[C@@]1(C)CCC(O[Si](C)(C)C)=C(C)[C@@H]1CC2 |
| InChI | InChI=1S/C24H38O3Si/c1-15(2)18-14-21(25-5)22-17(23(18)26-6)10-11-19-16(3)20(27-28(7,8)9)12-13-24(19,22)4/h14-15,19H,10-13H2,1-9H3/t19-,24-/m0/s1 |
| InChIKey | FJPJWQKMHBQYCQ-CYFREDJKSA-N |
| XLogP | 6.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|