C20H26O3 — CID 162953694
methyl (4aS,10aS)-7-[(1R)-1-hydroxyethyl]-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate (PubChem CID 162953694) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl (4aS,10aS)-7-[(1R)-1-hydroxyethyl]-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate.
| Compound Name | methyl (4aS,10aS)-7-[(1R)-1-hydroxyethyl]-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 162953694 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl (4aS,10aS)-7-[(1R)-1-hydroxyethyl]-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@@H]2CCc3cc([C@@H](C)O)ccc3[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H26O3/c1-12-16(19(22)23-4)9-10-20(3)17(12)7-6-15-11-14(13(2)21)5-8-18(15)20/h5,8,11,13,17,21H,6-7,9-10H2,1-4H3/t13-,17+,20+/m1/s1 |
| InChIKey | USXHFYBFCLZMFX-VOWSPCBNSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |