C31H41NO3 — CID 92697654
N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-(4-methoxyphenyl)-4-oxobutanamide (PubChem CID 92697654) has the molecular formula C31H41NO3 and a molecular weight of 475.67 g/mol. Its IUPAC name is N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-(4-methoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-(4-methoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 92697654 |
| Molecular Formula | C31H41NO3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | N-[[(1R,4aR,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-4-(4-methoxyphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)NC[C@]2(C)CCC[C@@]3(C)c4ccc(C(C)C)cc4CC[C@H]23)cc1 |
| InChI | InChI=1S/C31H41NO3/c1-21(2)23-9-13-26-24(19-23)10-15-28-30(3,17-6-18-31(26,28)4)20-32-29(34)16-14-27(33)22-7-11-25(35-5)12-8-22/h7-9,11-13,19,21,28H,6,10,14-18,20H2,1-5H3,(H,32,34)/t28-,30+,31+/m1/s1 |
| InChIKey | IMPHXROZCFVAGG-LMERMFHRSA-N |
| XLogP | 6.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |