C30H41NOS — CID 10095946
3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylamino]-1-(4-methylsulfanylphenyl)propan-1-one (PubChem CID 10095946) has the molecular formula C30H41NOS and a molecular weight of 463.73 g/mol. Its IUPAC name is 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylamino]-1-(4-methylsulfanylphenyl)propan-1-one.
| Compound Name | 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylamino]-1-(4-methylsulfanylphenyl)propan-1-one |
|---|---|
| PubChem CID | 10095946 |
| Molecular Formula | C30H41NOS |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 3-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methylamino]-1-(4-methylsulfanylphenyl)propan-1-one |
| SMILES | CSc1ccc(C(=O)CCNCC2(C)CCCC3(C)c4ccc(C(C)C)cc4CCC23)cc1 |
| InChI | InChI=1S/C30H41NOS/c1-21(2)23-9-13-26-24(19-23)10-14-28-29(3,16-6-17-30(26,28)4)20-31-18-15-27(32)22-7-11-25(33-5)12-8-22/h7-9,11-13,19,21,28,31H,6,10,14-18,20H2,1-5H3 |
| InChIKey | VCTFPSQFNBMZCD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|