C23H32O11 — CID 162932740
[6,10-diacetyloxy-3-(ethoxymethyl)-6a,9-dihydroxy-6,9-dimethyl-2-oxo-5,7,8,10-tetrahydro-4H-benzo[h][1]benzofuran-4-yl] acetate (PubChem CID 162932740) has the molecular formula C23H32O11 and a molecular weight of 484.50 g/mol. Its IUPAC name is [6,10-diacetyloxy-3-(ethoxymethyl)-6a,9-dihydroxy-6,9-dimethyl-2-oxo-5,7,8,10-tetrahydro-4H-benzo[h][1]benzofuran-4-yl] acetate.
| Compound Name | [6,10-diacetyloxy-3-(ethoxymethyl)-6a,9-dihydroxy-6,9-dimethyl-2-oxo-5,7,8,10-tetrahydro-4H-benzo[h][1]benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 162932740 |
| Molecular Formula | C23H32O11 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [6,10-diacetyloxy-3-(ethoxymethyl)-6a,9-dihydroxy-6,9-dimethyl-2-oxo-5,7,8,10-tetrahydro-4H-benzo[h][1]benzofuran-4-yl] acetate |
| SMILES | CCOCC1=C2C(OC(C)=O)CC(C)(OC(C)=O)C3(O)CCC(C)(O)C(OC(C)=O)C23OC1=O |
| InChI | InChI=1S/C23H32O11/c1-7-30-11-15-17-16(31-12(2)24)10-21(6,33-14(4)26)22(29)9-8-20(5,28)19(32-13(3)25)23(17,22)34-18(15)27/h16,19,28-29H,7-11H2,1-6H3 |
| InChIKey | LGJQJUDAOYMIQX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|