C23H36O6 — CID 162933277
[3-hydroxy-4-(6-hydroxyhexyl)-1-[2-(4-hydroxy-3-methoxyphenyl)ethyl]cyclohexyl] acetate (PubChem CID 162933277) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is [3-hydroxy-4-(6-hydroxyhexyl)-1-[2-(4-hydroxy-3-methoxyphenyl)ethyl]cyclohexyl] acetate.
| Compound Name | [3-hydroxy-4-(6-hydroxyhexyl)-1-[2-(4-hydroxy-3-methoxyphenyl)ethyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 162933277 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [3-hydroxy-4-(6-hydroxyhexyl)-1-[2-(4-hydroxy-3-methoxyphenyl)ethyl]cyclohexyl] acetate |
| SMILES | COc1cc(CCC2(OC(C)=O)CCC(CCCCCCO)C(O)C2)ccc1O |
| InChI | InChI=1S/C23H36O6/c1-17(25)29-23(12-10-18-8-9-20(26)22(15-18)28-2)13-11-19(21(27)16-23)7-5-3-4-6-14-24/h8-9,15,19,21,24,26-27H,3-7,10-14,16H2,1-2H3 |
| InChIKey | MZUJFBWKTSQUIW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|