C28H44O6 — CID 163082243
[(1S,3R,4R)-1-[2-(3-cyclopentyloxy-4-hydroxyphenyl)ethyl]-3-hydroxy-4-(7-hydroxyheptyl)cyclohexyl] acetate (PubChem CID 163082243) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is [(1S,3R,4R)-1-[2-(3-cyclopentyloxy-4-hydroxyphenyl)ethyl]-3-hydroxy-4-(7-hydroxyheptyl)cyclohexyl] acetate.
| Compound Name | [(1S,3R,4R)-1-[2-(3-cyclopentyloxy-4-hydroxyphenyl)ethyl]-3-hydroxy-4-(7-hydroxyheptyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 163082243 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | [(1S,3R,4R)-1-[2-(3-cyclopentyloxy-4-hydroxyphenyl)ethyl]-3-hydroxy-4-(7-hydroxyheptyl)cyclohexyl] acetate |
| SMILES | CC(=O)O[C@]1(CCc2ccc(O)c(OC3CCCC3)c2)CC[C@@H](CCCCCCCO)[C@H](O)C1 |
| InChI | InChI=1S/C28H44O6/c1-21(30)34-28(17-15-23(26(32)20-28)9-5-3-2-4-8-18-29)16-14-22-12-13-25(31)27(19-22)33-24-10-6-7-11-24/h12-13,19,23-24,26,29,31-32H,2-11,14-18,20H2,1H3/t23-,26-,28-/m1/s1 |
| InChIKey | FVNPJRXSLLOWSE-KODFZCBSSA-N |
| XLogP | 5.44 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|