C26H42O5 — CID 162934378
methyl 3-ethoxy-3-[2-hydroxy-4-oxo-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclopentyl]propanoate (PubChem CID 162934378) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl 3-ethoxy-3-[2-hydroxy-4-oxo-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclopentyl]propanoate.
| Compound Name | methyl 3-ethoxy-3-[2-hydroxy-4-oxo-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 162934378 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl 3-ethoxy-3-[2-hydroxy-4-oxo-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclopentyl]propanoate |
| SMILES | CCOC(CC(=O)OC)C1(CC=C(C)CCC=C(C)CCC=C(C)C)CC(=O)CC1O |
| InChI | InChI=1S/C26H42O5/c1-7-31-24(17-25(29)30-6)26(18-22(27)16-23(26)28)15-14-21(5)13-9-12-20(4)11-8-10-19(2)3/h10,12,14,23-24,28H,7-9,11,13,15-18H2,1-6H3 |
| InChIKey | ITVCHIDREWUTCJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|