C22H26O7 — CID 162934985
3-[4-[(1S,2R)-2-ethoxy-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propoxy]-3-methoxyphenyl]prop-2-enal (PubChem CID 162934985) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-[4-[(1S,2R)-2-ethoxy-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propoxy]-3-methoxyphenyl]prop-2-enal.
| Compound Name | 3-[4-[(1S,2R)-2-ethoxy-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propoxy]-3-methoxyphenyl]prop-2-enal |
|---|---|
| PubChem CID | 162934985 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[4-[(1S,2R)-2-ethoxy-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propoxy]-3-methoxyphenyl]prop-2-enal |
| SMILES | CCO[C@H](CO)[C@@H](Oc1ccc(C=CC=O)cc1OC)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C22H26O7/c1-4-28-21(14-24)22(16-8-9-17(25)19(13-16)26-2)29-18-10-7-15(6-5-11-23)12-20(18)27-3/h5-13,21-22,24-25H,4,14H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | BSICIQGJYAQPRY-YADHBBJMSA-N |
| XLogP | 3.14 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|