C22H32O8 — CID 87710604
4-(diethoxymethyl)-2-methoxyphenol;ethanol;4-hydroxy-3-methoxybenzaldehyde (PubChem CID 87710604) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is 4-(diethoxymethyl)-2-methoxyphenol;ethanol;4-hydroxy-3-methoxybenzaldehyde.
| Compound Name | 4-(diethoxymethyl)-2-methoxyphenol;ethanol;4-hydroxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 87710604 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-(diethoxymethyl)-2-methoxyphenol;ethanol;4-hydroxy-3-methoxybenzaldehyde |
| SMILES | CCO.CCOC(OCC)c1ccc(O)c(OC)c1.COc1cc(C=O)ccc1O |
| InChI | InChI=1S/C12H18O4.C8H8O3.C2H6O/c1-4-15-12(16-5-2)9-6-7-10(13)11(8-9)14-3;1-11-8-4-6(5-9)2-3-7(8)10;1-2-3/h6-8,12-13H,4-5H2,1-3H3;2-5,10H,1H3;3H,2H2,1H3 |
| InChIKey | ZMXTXHZEHRLDKM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|