C19H22O6 — CID 163996299
4-[(2R,3R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-3-methoxybenzaldehyde (PubChem CID 163996299) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[(2R,3R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-3-methoxybenzaldehyde.
| Compound Name | 4-[(2R,3R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 163996299 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[(2R,3R)-1-hydroxy-3-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-3-methoxybenzaldehyde |
| SMILES | COc1cc([C@@H](C)[C@H](CO)Oc2ccc(C=O)cc2OC)ccc1O |
| InChI | InChI=1S/C19H22O6/c1-12(14-5-6-15(22)17(9-14)23-2)19(11-21)25-16-7-4-13(10-20)8-18(16)24-3/h4-10,12,19,21-22H,11H2,1-3H3/t12-,19+/m1/s1 |
| InChIKey | UEZLCEFDHZCKTE-BLVKFPJESA-N |
| XLogP | 2.77 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|