C37H44O9S2 — CID 162935605
13-(4-hydroxy-3,5-dimethoxyphenyl)-9-(2-hydroxyethoxy)-26-(hydroxymethyl)-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol (PubChem CID 162935605) has the molecular formula C37H44O9S2 and a molecular weight of 696.88 g/mol. Its IUPAC name is 13-(4-hydroxy-3,5-dimethoxyphenyl)-9-(2-hydroxyethoxy)-26-(hydroxymethyl)-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol.
| Compound Name | 13-(4-hydroxy-3,5-dimethoxyphenyl)-9-(2-hydroxyethoxy)-26-(hydroxymethyl)-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol |
|---|---|
| PubChem CID | 162935605 |
| Molecular Formula | C37H44O9S2 |
| Molecular Weight | 696.88 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | 13-(4-hydroxy-3,5-dimethoxyphenyl)-9-(2-hydroxyethoxy)-26-(hydroxymethyl)-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol |
| SMILES | COc1cc(C2Oc3cc(OCCO)c4c5c3C(CSSC3CCCC(CCC(c6cc(O)ccc6-4)C5CO)C3)C2O)cc(OC)c1O |
| InChI | InChI=1S/C37H44O9S2/c1-43-30-13-20(14-31(44-2)36(30)42)37-35(41)27-18-47-48-22-5-3-4-19(12-22)6-8-23-25-15-21(40)7-9-24(25)32-28(45-11-10-38)16-29(46-37)33(27)34(32)26(23)17-39/h7,9,13-16,19,22-23,26-27,35,37-42H,3-6,8,10-12,17-18H2,1-2H3 |
| InChIKey | WTTMGKRANVEFIH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.88 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|