C35H40O7S2 — CID 162831661
(1S,13S,14R,15S,19R,23R)-13-(4-hydroxy-3,5-dimethoxyphenyl)-9-methoxy-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol (PubChem CID 162831661) has the molecular formula C35H40O7S2 and a molecular weight of 636.83 g/mol. Its IUPAC name is (1S,13S,14R,15S,19R,23R)-13-(4-hydroxy-3,5-dimethoxyphenyl)-9-methoxy-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol.
| Compound Name | (1S,13S,14R,15S,19R,23R)-13-(4-hydroxy-3,5-dimethoxyphenyl)-9-methoxy-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol |
|---|---|
| PubChem CID | 162831661 |
| Molecular Formula | C35H40O7S2 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | (1S,13S,14R,15S,19R,23R)-13-(4-hydroxy-3,5-dimethoxyphenyl)-9-methoxy-12-oxa-17,18-dithiahexacyclo[13.10.3.119,23.02,7.08,27.011,28]nonacosa-2(7),3,5,8,10,27-hexaene-4,14-diol |
| SMILES | COc1cc([C@@H]2Oc3cc(OC)c4c5c3[C@H](CSS[C@@H]3CCC[C@H](CC[C@@H](C5)c5cc(O)ccc5-4)C3)[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C35H40O7S2/c1-39-27-16-28-32-25-12-19(24-15-21(36)9-10-23(24)31(25)27)8-7-18-5-4-6-22(11-18)44-43-17-26(32)33(37)35(42-28)20-13-29(40-2)34(38)30(14-20)41-3/h9-10,13-16,18-19,22,26,33,35-38H,4-8,11-12,17H2,1-3H3/t18-,19+,22-,26+,33-,35+/m1/s1 |
| InChIKey | QFRWYUGDTDFVAP-JPYFWSMLSA-N |
| XLogP | 7.74 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|