C17H34AsO14S+ — CID 162939923
[(2S)-2-carboxy-3-(2,3-dihydroxypropoxy)propyl]-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2S)-2-hydroxy-3-sulfooxypropoxy]oxolan-2-yl]methyl]-dimethylarsanium (PubChem CID 162939923) has the molecular formula C17H34AsO14S+ and a molecular weight of 569.43 g/mol. Its IUPAC name is [(2S)-2-carboxy-3-(2,3-dihydroxypropoxy)propyl]-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2S)-2-hydroxy-3-sulfooxypropoxy]oxolan-2-yl]methyl]-dimethylarsanium.
| Compound Name | [(2S)-2-carboxy-3-(2,3-dihydroxypropoxy)propyl]-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2S)-2-hydroxy-3-sulfooxypropoxy]oxolan-2-yl]methyl]-dimethylarsanium |
|---|---|
| PubChem CID | 162939923 |
| Molecular Formula | C17H34AsO14S+ |
| Molecular Weight | 569.43 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | [(2S)-2-carboxy-3-(2,3-dihydroxypropoxy)propyl]-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2S)-2-hydroxy-3-sulfooxypropoxy]oxolan-2-yl]methyl]-dimethylarsanium |
| SMILES | C[As+](C)(C[C@@H](COCC(O)CO)C(=O)O)C[C@H]1O[C@@H](OC[C@H](O)COS(=O)(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H33AsO14S/c1-18(2,3-10(16(24)25)6-29-7-11(20)5-19)4-13-14(22)15(23)17(32-13)30-8-12(21)9-31-33(26,27)28/h10-15,17,19-23H,3-9H2,1-2H3,(H-,24,25,26,27,28)/p+1/t10-,11?,12-,13+,14+,15+,17+/m0/s1 |
| InChIKey | LVQMZMNFGSNIOL-DUZSTECCSA-O |
| XLogP | -2.59 |
| TPSA | 229.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.43 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|