C30H50O — CID 162941497
(3R,8R,9S,10R,13R,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,7,8,9,11,12,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 162941497) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (3R,8R,9S,10R,13R,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,7,8,9,11,12,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8R,9S,10R,13R,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,7,8,9,11,12,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 162941497 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (3R,8R,9S,10R,13R,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,7,8,9,11,12,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@H](C)[C@H]1C=C[C@@]2(C)[C@@H]3CC=C4C(C)(C)[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h13-14,18,20-24,26,31H,9-12,15-17,19H2,1-8H3/t21-,22+,23-,24+,26+,28+,29+,30-/m0/s1 |
| InChIKey | URBRLQJOPJWBFC-KDDLORMESA-N |
| XLogP | 8.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|