C38H60N2O2 — CID 58324009
5-[hydroperoxy-[4,4,10,13,14-pentamethyl-17-(7-methyloct-6-en-2-yl)-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine (PubChem CID 58324009) has the molecular formula C38H60N2O2 and a molecular weight of 576.91 g/mol. Its IUPAC name is 5-[hydroperoxy-[4,4,10,13,14-pentamethyl-17-(7-methyloct-6-en-2-yl)-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine.
| Compound Name | 5-[hydroperoxy-[4,4,10,13,14-pentamethyl-17-(7-methyloct-6-en-2-yl)-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 58324009 |
| Molecular Formula | C38H60N2O2 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.47 |
| IUPAC Name | 5-[hydroperoxy-[4,4,10,13,14-pentamethyl-17-(7-methyloct-6-en-2-yl)-2,3,7,8,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]benzene-1,3-diamine |
| SMILES | CC(C)=CCCCC(C)C1CCC2(C)C3CC=C4C(C)(C)C(C(OO)c5cc(N)cc(N)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H60N2O2/c1-24(2)11-9-10-12-25(3)29-16-19-38(8)31-13-14-33-35(4,5)32(34(42-41)26-21-27(39)23-28(40)22-26)15-18-36(33,6)30(31)17-20-37(29,38)7/h11,14,21-23,25,29-32,34,41H,9-10,12-13,15-20,39-40H2,1-8H3 |
| InChIKey | JHKROIXXHQQGNL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|