C23H28O6 — CID 162951057
7-[[(2R,3S,4R,4aS,8R,8aS)-2-hydroxy-3,4a,8,8a-tetramethyl-7-oxo-2,3,4,5,6,8-hexahydrochromen-4-yl]methoxy]chromen-2-one (PubChem CID 162951057) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 7-[[(2R,3S,4R,4aS,8R,8aS)-2-hydroxy-3,4a,8,8a-tetramethyl-7-oxo-2,3,4,5,6,8-hexahydrochromen-4-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[(2R,3S,4R,4aS,8R,8aS)-2-hydroxy-3,4a,8,8a-tetramethyl-7-oxo-2,3,4,5,6,8-hexahydrochromen-4-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 162951057 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 7-[[(2R,3S,4R,4aS,8R,8aS)-2-hydroxy-3,4a,8,8a-tetramethyl-7-oxo-2,3,4,5,6,8-hexahydrochromen-4-yl]methoxy]chromen-2-one |
| SMILES | C[C@@H]1[C@H](O)O[C@@]2(C)[C@@H](C)C(=O)CC[C@@]2(C)[C@@H]1COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C23H28O6/c1-13-17(12-27-16-7-5-15-6-8-20(25)28-19(15)11-16)22(3)10-9-18(24)14(2)23(22,4)29-21(13)26/h5-8,11,13-14,17,21,26H,9-10,12H2,1-4H3/t13-,14-,17+,21+,22-,23-/m0/s1 |
| InChIKey | SGAGBYUEVHJQBY-OTQMHGQZSA-N |
| XLogP | 3.54 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|